CAS 1394175-19-9 appears in our catalog under these names: 1-Methyl-1h-pyrrolo[2,3-c]pyridine-3-carboxylic acid, 95%, 1-Methyl-1H-pyrrolo(2,3-c)pyridine-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 50mg, 0,5g.
1-methylpyrrolo[2,3-c]pyridine-3-carboxylic acid (CAS 1394175-19-9) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 1-methylpyrrolo[2,3-c]pyridine-3-carboxylic acid. InChIKey: REAWBUYYYAJMCH-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 1-methylpyrrolo[2,3-c]pyridine-3-carboxylic acid |
| InChIKey | REAWBUYYYAJMCH-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=NC=C2)C(=O)O |
Computed by PubChem (NCBI)