Products 139452-21-4
CAS 139452-21-4 appears in our catalog under these names: 6-Methylpyrazolo[1,5-a]pyridine-3-carboxylic acid, 95%, 6-Methylpyrazolo(1,5-a)pyridine-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
6-methylpyrazolo[1,5-a]pyridine-3-carboxylic acid (CAS 139452-21-4) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 6-methylpyrazolo[1,5-a]pyridine-3-carboxylic acid. InChIKey: OGHHZABNTXETHB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 6-methylpyrazolo[1,5-a]pyridine-3-carboxylic acid |
| InChIKey | OGHHZABNTXETHB-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=C(C=N2)C(=O)O)C=C1 |
Computed by PubChem (NCBI)