CAS 139503-88-1 is the registry number for 3,5,7-Trihydroxychroman-4-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5,7-trihydroxy-2,3-dihydrochromen-4-one (CAS 139503-88-1) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 3,5,7-trihydroxy-2,3-dihydrochromen-4-one. InChIKey: BILGYFCIODXDLL-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 3,5,7-trihydroxy-2,3-dihydrochromen-4-one |
| InChIKey | BILGYFCIODXDLL-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)C2=C(C=C(C=C2O1)O)O)O |
Computed by PubChem (NCBI)