Products 1395070-53-7
CAS 1395070-53-7 is the registry number for 2–Methyl–6–trifluoromethylpyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-methyl-6-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 1395070-53-7) is a chemical compound with the molecular formula C7H7BF3NO2 and a molecular weight of 204.94 g/mol. IUPAC name: [2-methyl-6-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: GZOHHVSZSMINLZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO2 |
|---|---|
| Molecular weight | 204.94 g/mol |
| IUPAC name | [2-methyl-6-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | GZOHHVSZSMINLZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)C(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)