CAS 796857-60-8 is the registry number for 3–Amino–5–(Trofluoromethyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[3-amino-5-(trifluoromethyl)phenyl]boronic acid (CAS 796857-60-8) is a chemical compound with the molecular formula C7H7BF3NO2 and a molecular weight of 204.94 g/mol. IUPAC name: [3-amino-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: SUGWONCXKGBIHA-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO2 |
|---|---|
| Molecular weight | 204.94 g/mol |
| IUPAC name | [3-amino-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | SUGWONCXKGBIHA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)