CAS 2225169-14-0 is the registry number for 2–Methyl–5–(trifluoromethyl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[2-methyl-5-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 2225169-14-0) is a chemical compound with the molecular formula C7H7BF3NO2 and a molecular weight of 204.94 g/mol. IUPAC name: [2-methyl-5-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: HJILMIUARIVXKS-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO2 |
|---|---|
| Molecular weight | 204.94 g/mol |
| IUPAC name | [2-methyl-5-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | HJILMIUARIVXKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)