Products 1793091-29-8
CAS 1793091-29-8 appears in our catalog under these names: [2-amino-5-(trifluoromethyl)phenyl]boronic acid, 98%, 98%, (2-Amino-5-(trifluoromethyl)phenyl)boronic acid, 98%, (2-Amino-5-(trifluoromethyl)phenyl)boronic acid, 95% HPLC. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
[2-amino-5-(trifluoromethyl)phenyl]boronic acid (CAS 1793091-29-8) is a chemical compound with the molecular formula C7H7BF3NO2 and a molecular weight of 204.94 g/mol. IUPAC name: [2-amino-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: GBIGUIVUUCIHGT-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO2 |
|---|---|
| Molecular weight | 204.94 g/mol |
| IUPAC name | [2-amino-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | GBIGUIVUUCIHGT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)N)(O)O |
Computed by PubChem (NCBI)