Products 2225174-44-5
CAS 2225174-44-5 is the registry number for 2–(Methyl–d3)–6–trifluoromethylpyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-(trideuteriomethyl)-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS 2225174-44-5) is a chemical compound with the molecular formula C7H7BF3NO2 and a molecular weight of 207.96 g/mol. IUPAC name: [2-(trideuteriomethyl)-6-(trifluoromethyl)-4-pyridinyl]boronic acid. InChIKey: SMNYBZRQYASFJL-FIBGUPNXSA-N.
| Molecular formula | C7H7BF3NO2 |
|---|---|
| Molecular weight | 207.96 g/mol |
| IUPAC name | [2-(trideuteriomethyl)-6-(trifluoromethyl)-4-pyridinyl]boronic acid |
| InChIKey | SMNYBZRQYASFJL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC(=CC(=C1)B(O)O)C(F)(F)F |
Computed by PubChem (NCBI)