CAS 1889221-03-7 appears in our catalog under these names: 3-Methyl-2-trifluoromethylpyridine-5-boronic acid, 95%, 5–Methyl–6–trifluoromethylpyridine–3–boronic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 25mg, 5mg.
[5-methyl-6-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 1889221-03-7) is a chemical compound with the molecular formula C7H7BF3NO2 and a molecular weight of 204.94 g/mol. IUPAC name: [5-methyl-6-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: WALYHQGLFGHGQF-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO2 |
|---|---|
| Molecular weight | 204.94 g/mol |
| IUPAC name | [5-methyl-6-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | WALYHQGLFGHGQF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)C(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)