CAS 1889221-15-1 appears in our catalog under these names: (6-Methyl-5-(trifluoromethyl)pyridin-3-yl)boronic acid, 95%, (6–Methyl–5–(trifluoromethyl)pyridin–3–yl)boronic acid, Boronic acid, B-[6-methyl-5-(trifluoromethyl)-3-pyridinyl]-, 98%, 98%, (6-METHYL-5-(TRIFLUOROMETHYL)PYRIDIN-3-YL)BORONIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
[6-methyl-5-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 1889221-15-1) is a chemical compound with the molecular formula C7H7BF3NO2 and a molecular weight of 204.94 g/mol. IUPAC name: [6-methyl-5-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: BPTCKBBULUZEIR-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO2 |
|---|---|
| Molecular weight | 204.94 g/mol |
| IUPAC name | [6-methyl-5-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | BPTCKBBULUZEIR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)