Products 1396962-67-6
CAS 1396962-67-6 appears in our catalog under these names: 2-((Pyridin-3-ylmethyl)amino)propanoic acid dihydrochloride, 98%, 2-((Pyridin-3-ylmethyl)amino)propanoic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 100mg, 1g.
2-(pyridin-3-ylmethylamino)propanoic acid;dihydrochloride (CAS 1396962-67-6) is a chemical compound with the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.12 g/mol. IUPAC name: 2-(pyridin-3-ylmethylamino)propanoic acid;dihydrochloride. InChIKey: DHHBAIPCAQDYQG-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 2-(pyridin-3-ylmethylamino)propanoic acid;dihydrochloride |
| InChIKey | DHHBAIPCAQDYQG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NCC1=CN=CC=C1.Cl.Cl |
Computed by PubChem (NCBI)