CAS 139962-95-1 appears in our catalog under these names: 4-Methoxy-2-formylphenylboronic acid/ 95+%, 2–Formyl–4–methoxyphenylboronic acid, 2-Formyl-4-methoxyphenylboronic Acid (contains varying amounts of Anhydride), 2-Formyl-4-methoxyphenylboronic acid 97%, 2-Formyl-4-methoxyphenylboronic acid, 97%, 97%. Offered by: Chemat, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.
(2-formyl-4-methoxyphenyl)boronic acid (CAS 139962-95-1) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: (2-formyl-4-methoxyphenyl)boronic acid. InChIKey: ZSSNGMFKYFBOAG-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | (2-formyl-4-methoxyphenyl)boronic acid |
| InChIKey | ZSSNGMFKYFBOAG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)C=O)(O)O |
Computed by PubChem (NCBI)