CAS 14026-45-0 appears in our catalog under these names: 6-Nitro-1,2,3,4-tetrahydroquinoline, 96%, 6–Nitro–1,2,3,4–tetrahydroquinoline, 6-Nitro-1,2,3,4-tetrahydroquinoline, 95%, 95%, 6-NITRO-1,2,3,4-TETRAHYDROQUINOLINE, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg, 25g.
6-nitro-1,2,3,4-tetrahydroquinoline (CAS 14026-45-0) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 6-nitro-1,2,3,4-tetrahydroquinoline. InChIKey: ASVYHMUYLBMSKW-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 6-nitro-1,2,3,4-tetrahydroquinoline |
| InChIKey | ASVYHMUYLBMSKW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)[N+](=O)[O-])NC1 |
Computed by PubChem (NCBI)