Products 1402742-26-0
CAS 1402742-26-0 appears in our catalog under these names: tert-Butyl 3,5-difluoropicolinate, 98%, 98%, tert-Butyl 3,5-difluoropicolinate, 95%, tert-Butyl 3,5-difluoropicolinate, 98%. Offered by: Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
Tert-butyl 3,5-difluoropyridine-2-carboxylate (CAS 1402742-26-0) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: tert-butyl 3,5-difluoropyridine-2-carboxylate. InChIKey: VXTUQTHKZWUNDC-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | tert-butyl 3,5-difluoropyridine-2-carboxylate |
| InChIKey | VXTUQTHKZWUNDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=N1)F)F |
Computed by PubChem (NCBI)