Products 1404370-64-4
CAS 1404370-64-4 appears in our catalog under these names: Ethyl 5-benzoxazolecarboxylate, 95%, Ethyl 5-benzoxazolecarboxylate, 98%, Ethyl 5–Benzoxazolecarboxylate, Ethyl 5-Benzoxazolecarboxylate, 97%, 97%, Ethyl benzo[d]oxazole-5-carboxylate, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg, 100mg.
Ethyl 1,3-benzoxazole-5-carboxylate (CAS 1404370-64-4) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: ethyl 1,3-benzoxazole-5-carboxylate. InChIKey: NYONLFVSTRIQFN-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | ethyl 1,3-benzoxazole-5-carboxylate |
| InChIKey | NYONLFVSTRIQFN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)OC=N2 |
Computed by PubChem (NCBI)