CAS 140923-27-9 appears in our catalog under these names: (S)-2-((Isopropoxycarbonyl)amino)-3-methylbutanoic acid, 95+%, (2S)-3-Methyl-2-{((propan-2-yloxy)carbonyl)amino}butanoic acid, (2s)-3-Methyl-2-{[(propan-2-yloxy)carbonyl]amino}butanoic acid, 95%. Offered by: AmBeed, Biosynth, Fluorochem, Chemat. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g.
(2S)-3-methyl-2-(propan-2-yloxycarbonylamino)butanoic acid (CAS 140923-27-9) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2S)-3-methyl-2-(propan-2-yloxycarbonylamino)butanoic acid. InChIKey: BOEQBJGCRDSQAI-ZETCQYMHSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2S)-3-methyl-2-(propan-2-yloxycarbonylamino)butanoic acid |
| InChIKey | BOEQBJGCRDSQAI-ZETCQYMHSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)OC(C)C |
Computed by PubChem (NCBI)