CAS 141068-81-7 appears in our catalog under these names: 7-Amino-4-methyl-2h-1,4-benzoxazin-3(4h)-one, 95%, 7-Amino-4-methyl-2H-1,4-benzoxazin-3(4H)-one, 7-Amino-4-methyl-2H-benzo[b][1,4]oxazin-3(4H)-one 95%, 7-Amino-4-methyl-2h-1,4-benzoxazin-3(4h)-one, 97%, 97%, 7-Amino-4-methyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 2,5g, 100mg, 500mg, 2.5g, 10g.
7-amino-4-methyl-1,4-benzoxazin-3-one (CAS 141068-81-7) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 7-amino-4-methyl-1,4-benzoxazin-3-one. InChIKey: JVYJTIARQJQCKK-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 7-amino-4-methyl-1,4-benzoxazin-3-one |
| InChIKey | JVYJTIARQJQCKK-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=C1C=CC(=C2)N |
Computed by PubChem (NCBI)