CAS 141109-17-3 appears in our catalog under these names: Methyl 2–amino–2–(2–chlorophenyl)acetate hydrochloride, Methyl amino(2-chlorophenyl)acetate hydrochloride, Methyl 2-amino-2-(2-chlorophenyl)acetate hydrochloride 97%, Benzeneacetic acid, α-amino-2-chloro-, methyl ester, hydrochloride (1:1), 97%, 97%, methyl amino(2-chlorophenyl)acetate hydrochloride, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 100g, 250mg, 2.5g.
Methyl 2-amino-2-(2-chlorophenyl)acetate;hydrochloride (CAS 141109-17-3) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: methyl 2-amino-2-(2-chlorophenyl)acetate;hydrochloride. InChIKey: SUUNIMMHDPICBD-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | methyl 2-amino-2-(2-chlorophenyl)acetate;hydrochloride |
| InChIKey | SUUNIMMHDPICBD-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=CC=C1Cl)N.Cl |
Computed by PubChem (NCBI)