CAS 212838-70-5 appears in our catalog under these names: Clopidogrel Impurity 5 HCl, (R)-(-)-2-Chlorophenylglycine Methyl Ester Hydrochloride, >95% (HPLC), D-(-)-2-Chlorophenylglycine methyl ester hydrochloride, (R)-Methyl 2-amino-2-(2-chlorophenyl)acetate hydrochloride 98%, (R)-Methyl 2-amino-2-(2-chlorophenyl)acetate hydrochloride, 97%, 97%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 500mg, 25g, 10g, 50g, 100g, 250mg, 1g.
Methyl (2R)-2-amino-2-(2-chlorophenyl)acetate;hydrochloride (CAS 212838-70-5) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: methyl (2R)-2-amino-2-(2-chlorophenyl)acetate;hydrochloride. InChIKey: SUUNIMMHDPICBD-DDWIOCJRSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(2-chlorophenyl)acetate;hydrochloride |
| InChIKey | SUUNIMMHDPICBD-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=CC=C1Cl)N.Cl |
Computed by PubChem (NCBI)