CAS 141238-23-5 appears in our catalog under these names: 3-Chloro-5-nitropicolinic acid 98%, 3-Chloro-5-nitropicolinic acid, 95%, 3-Chloro-5-nitropicolinic acid, 98%, 98%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 2.5g.
3-chloro-5-nitropyridine-2-carboxylic acid (CAS 141238-23-5) is a chemical compound with the molecular formula C6H3ClN2O4 and a molecular weight of 202.55 g/mol. IUPAC name: 3-chloro-5-nitropyridine-2-carboxylic acid. InChIKey: BNPDDLSKUUEFAA-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O4 |
|---|---|
| Molecular weight | 202.55 g/mol |
| IUPAC name | 3-chloro-5-nitropyridine-2-carboxylic acid |
| InChIKey | BNPDDLSKUUEFAA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)