Products 1412423-81-4
CAS 1412423-81-4 is the registry number for (3-(Quinolin-6-yl)-1,2,4-oxadiazol-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-quinolin-6-yl-1,2,4-oxadiazol-5-yl)methanol (CAS 1412423-81-4) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: (3-quinolin-6-yl-1,2,4-oxadiazol-5-yl)methanol. InChIKey: BDMVMKRYBCUFPZ-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | (3-quinolin-6-yl-1,2,4-oxadiazol-5-yl)methanol |
| InChIKey | BDMVMKRYBCUFPZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C3=NOC(=N3)CO)N=C1 |
Computed by PubChem (NCBI)