CAS 1414958-20-5 appears in our catalog under these names: Cis-4-tert-butoxycarbonylamino-tetrahydro-furan-3-carboxylic acid, 95%, cis-4-((tert-Butoxycarbonyl)amino)tetrahydrofuran-3-carboxylic acid, 98%, cis-4-tert-Butoxycarbonylamino-tetrahydro-furan-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 0,5g, 50mg.
(3R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-3-carboxylic acid (CAS 1414958-20-5) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (3R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-3-carboxylic acid. InChIKey: FUECAVZSGQIGRI-NKWVEPMBSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (3R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-3-carboxylic acid |
| InChIKey | FUECAVZSGQIGRI-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1COC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)