CAS 2165596-62-1 appears in our catalog under these names: (3S,4S)-4-{[(tert-butoxy)carbonyl]amino}oxolane-3-carboxylic acid, 98%, (3S,4S)-4-((tert-Butoxycarbonyl)amino)tetrahydrofuran-3-carboxylic acid, 98%, 98%, (3S,4S)-4-((tert-Butoxycarbonyl)amino)tetrahydrofuran-3-carboxylic acid, 98%. Offered by: Chemat Brand, Chemat, Ambeed. Available pack sizes: on request, 25mg, 50mg, 100mg, 250mg, 1g.
(3S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-3-carboxylic acid (CAS 2165596-62-1) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (3S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-3-carboxylic acid. InChIKey: FUECAVZSGQIGRI-RNFRBKRXSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (3S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-3-carboxylic acid |
| InChIKey | FUECAVZSGQIGRI-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1COC[C@H]1C(=O)O |
Computed by PubChem (NCBI)