CAS 1903427-02-0 appears in our catalog under these names: rel-(3R,4R)-4-((tert-Butoxycarbonyl)amino)tetrahydrofuran-3-carboxylic acid, 98%, rel-(3R,4R)-4-[[(1,1-Dimethylethoxy)carbonyl]amino]tetrahydro-3-furancarboxylic acid, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g.
(3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-3-carboxylic acid (CAS 1903427-02-0) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-3-carboxylic acid. InChIKey: FUECAVZSGQIGRI-BQBZGAKWSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-3-carboxylic acid |
| InChIKey | FUECAVZSGQIGRI-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)