CAS 1821806-18-1 appears in our catalog under these names: (3R,4R)-4-([(tert-Butoxy)carbonyl]amino)oxolane-3-carboxylic acid, 95%, (3R,4R)-4-{((tert-butoxy)carbonyl)amino}oxolane-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
(3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-3-carboxylic acid (CAS 1821806-18-1) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-3-carboxylic acid. InChIKey: FUECAVZSGQIGRI-BQBZGAKWSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-3-carboxylic acid |
| InChIKey | FUECAVZSGQIGRI-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)