Products 1415564-98-5
CAS 1415564-98-5 appears in our catalog under these names: 4-Fluoro-3-nitrophenyl pivalate, 95%, 95%, 4-Fluoro-3-nitrophenyl pivalate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(4-fluoro-3-nitrophenyl) 2,2-dimethylpropanoate (CAS 1415564-98-5) is a chemical compound with the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. IUPAC name: (4-fluoro-3-nitrophenyl) 2,2-dimethylpropanoate. InChIKey: JZHPBVPEPYHRLD-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO4 |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | (4-fluoro-3-nitrophenyl) 2,2-dimethylpropanoate |
| InChIKey | JZHPBVPEPYHRLD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC(=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-fluoro-3-nitrophenyl pivalate, Propanoic acid, 2,2-dimethyl-, 4-fluoro-3-nitrophenyl ester, (4-fluoro-3-nitrophenyl) 2,2-dimethylpropanoate, 4-Fluoro-3-nitrophenyl 2,2-dimethylpropanoate, (4-fluoro-3-nitro-phenyl) 2,2-dimethylpropanoate, Propanoicacid,2,2-dimethyl-,4-fluoro-3-nitrophenylester