CAS 1415717-67-7 is the registry number for 8-Hydroxy-3-methoxy-6H-benzo(c)chromen-6-one. Offered by: TRC. Available pack sizes: 50mg.
8-hydroxy-3-methoxybenzo[c]chromen-6-one (CAS 1415717-67-7) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 8-hydroxy-3-methoxybenzo[c]chromen-6-one. InChIKey: WLRUYVVMTATKCC-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 8-hydroxy-3-methoxybenzo[c]chromen-6-one |
| InChIKey | WLRUYVVMTATKCC-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C(C=C(C=C3)O)C(=O)O2 |
Computed by PubChem (NCBI)