Products 1416561-47-1

CAS 1416561-47-1 is the registry number for 6-Propionylpicolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-propanoylpyridine-2-carboxylic acid (CAS 1416561-47-1) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 6-propanoylpyridine-2-carboxylic acid. InChIKey: JNZMHKGLXQZYQG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO3
Molecular weight179.17 g/mol
IUPAC name6-propanoylpyridine-2-carboxylic acid
InChIKeyJNZMHKGLXQZYQG-UHFFFAOYSA-N
SMILESCCC(=O)C1=NC(=CC=C1)C(=O)O

Computed by PubChem (NCBI)