CAS 1416990-26-5 appears in our catalog under these names: 3-(4-Ethynyl-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%, 98%, Desamino lenalidomide-ethynyl, 3-(4-Ethynyl-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%. Offered by: Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100mg, 50mg, 250mg, 100 mg, 10 mg, 5 mg, 50 mg, 25 mg.
3-(7-ethynyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 1416990-26-5) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 3-(7-ethynyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: XDGQKMCRWMQCTQ-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 3-(7-ethynyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | XDGQKMCRWMQCTQ-UHFFFAOYSA-N |
| SMILES | C#CC1=C2CN(C(=O)C2=CC=C1)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)