Products 1419101-45-3
CAS 1419101-45-3 appears in our catalog under these names: 6，6–DIFLUOROSPIRO(3·3)HEPTANE–2–CARBOXYLIC ACID, 6,6-Difluorospiro[3.3]heptane-2-carboxylic acid, 97%, 6,6-difluorospiro(3.3)heptane-2-carboxylic acid, 6,6-Difluorospiro[3.3]heptane-2-carboxylic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 0,25g, 0,5g, 2g, 100mg, 500mg.
2,2-difluorospiro[3.3]heptane-6-carboxylic acid (CAS 1419101-45-3) is a chemical compound with the molecular formula C8H10F2O2 and a molecular weight of 176.16 g/mol. IUPAC name: 2,2-difluorospiro[3.3]heptane-6-carboxylic acid. InChIKey: XRVCRDQMFKNZJR-UHFFFAOYSA-N.
| Molecular formula | C8H10F2O2 |
|---|---|
| Molecular weight | 176.16 g/mol |
| IUPAC name | 2,2-difluorospiro[3.3]heptane-6-carboxylic acid |
| InChIKey | XRVCRDQMFKNZJR-UHFFFAOYSA-N |
| SMILES | C1C(CC12CC(C2)(F)F)C(=O)O |
Computed by PubChem (NCBI)