CAS 2248351-67-7 appears in our catalog under these names: 7,7-Difluorobicyclo(4.1.0)heptane-1-carboxylic acid, 98%, 7，7–difluorobicyclo(4·1·0)heptane–1–carboxylic acid, 7，7-difluorobicyclo[4.1.0]heptane-1-carboxylic acid. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
7,7-difluorobicyclo[4.1.0]heptane-1-carboxylic acid (CAS 2248351-67-7) is a chemical compound with the molecular formula C8H10F2O2 and a molecular weight of 176.16 g/mol. IUPAC name: 7,7-difluorobicyclo[4.1.0]heptane-1-carboxylic acid. InChIKey: GXQKHZIFBNBPQK-UHFFFAOYSA-N.
| Molecular formula | C8H10F2O2 |
|---|---|
| Molecular weight | 176.16 g/mol |
| IUPAC name | 7,7-difluorobicyclo[4.1.0]heptane-1-carboxylic acid |
| InChIKey | GXQKHZIFBNBPQK-UHFFFAOYSA-N |
| SMILES | C1CCC2(C(C1)C2(F)F)C(=O)O |
Computed by PubChem (NCBI)