Products 1865764-55-1

CAS 1865764-55-1 is the registry number for rel-(2R,4s)-5,5-difluorospiro[3.3]heptane-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7,7-difluorospiro[3.3]heptane-2-carboxylic acid (CAS 1865764-55-1) is a chemical compound with the molecular formula C8H10F2O2 and a molecular weight of 176.16 g/mol. IUPAC name: 7,7-difluorospiro[3.3]heptane-2-carboxylic acid. InChIKey: BAGZIUMGXAAWCU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10F2O2
Molecular weight176.16 g/mol
IUPAC name7,7-difluorospiro[3.3]heptane-2-carboxylic acid
InChIKeyBAGZIUMGXAAWCU-UHFFFAOYSA-N
SMILESC1CC(C12CC(C2)C(=O)O)(F)F

Computed by PubChem (NCBI)