CAS 1865764-55-1 is the registry number for rel-(2R,4s)-5,5-difluorospiro[3.3]heptane-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7,7-difluorospiro[3.3]heptane-2-carboxylic acid (CAS 1865764-55-1) is a chemical compound with the molecular formula C8H10F2O2 and a molecular weight of 176.16 g/mol. IUPAC name: 7,7-difluorospiro[3.3]heptane-2-carboxylic acid. InChIKey: BAGZIUMGXAAWCU-UHFFFAOYSA-N.
| Molecular formula | C8H10F2O2 |
|---|---|
| Molecular weight | 176.16 g/mol |
| IUPAC name | 7,7-difluorospiro[3.3]heptane-2-carboxylic acid |
| InChIKey | BAGZIUMGXAAWCU-UHFFFAOYSA-N |
| SMILES | C1CC(C12CC(C2)C(=O)O)(F)F |
Computed by PubChem (NCBI)