CAS 2101546-05-6 is the registry number for rel-Methyl (1R,3s,5S)-6,6-difluorobicyclo[3.1.0]hexane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (1S,5R)-6,6-difluorobicyclo[3.1.0]hexane-3-carboxylate (CAS 2101546-05-6) is a chemical compound with the molecular formula C8H10F2O2 and a molecular weight of 176.16 g/mol. IUPAC name: methyl (1S,5R)-6,6-difluorobicyclo[3.1.0]hexane-3-carboxylate. InChIKey: UEJNIGHPMYGIDX-GOHHTPAQSA-N.
| Molecular formula | C8H10F2O2 |
|---|---|
| Molecular weight | 176.16 g/mol |
| IUPAC name | methyl (1S,5R)-6,6-difluorobicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | UEJNIGHPMYGIDX-GOHHTPAQSA-N |
| SMILES | COC(=O)C1C[C@@H]2[C@H](C1)C2(F)F |
Computed by PubChem (NCBI)