CAS 2218436-73-6 is the registry number for rac-(1R,3R,6S)-7,7-Difluorobicyclo(4.1.0)heptane-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,3R,6S)-7,7-difluorobicyclo[4.1.0]heptane-3-carboxylic acid (CAS 2218436-73-6) is a chemical compound with the molecular formula C8H10F2O2 and a molecular weight of 176.16 g/mol. IUPAC name: (1R,3R,6S)-7,7-difluorobicyclo[4.1.0]heptane-3-carboxylic acid. InChIKey: MYWUIPSUJMURKN-NGJCXOISSA-N.
| Molecular formula | C8H10F2O2 |
|---|---|
| Molecular weight | 176.16 g/mol |
| IUPAC name | (1R,3R,6S)-7,7-difluorobicyclo[4.1.0]heptane-3-carboxylic acid |
| InChIKey | MYWUIPSUJMURKN-NGJCXOISSA-N |
| SMILES | C1C[C@H]2[C@H](C2(F)F)C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)