CAS 2744318-68-9 is the registry number for rel-(1R,2S,4R)-6,6-Difluorobicyclo[2.2.1]heptane-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2S,4R)-6,6-difluorobicyclo[2.2.1]heptane-2-carboxylic acid (CAS 2744318-68-9) is a chemical compound with the molecular formula C8H10F2O2 and a molecular weight of 176.16 g/mol. IUPAC name: (1R,2S,4R)-6,6-difluorobicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: HLWPDRAUGAAWBR-NGJCXOISSA-N.
| Molecular formula | C8H10F2O2 |
|---|---|
| Molecular weight | 176.16 g/mol |
| IUPAC name | (1R,2S,4R)-6,6-difluorobicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | HLWPDRAUGAAWBR-NGJCXOISSA-N |
| SMILES | C1[C@@H]2C[C@H]([C@H]1C(=O)O)C(C2)(F)F |
Computed by PubChem (NCBI)