CAS 2248316-21-2 is the registry number for 7,7-Difluorobicyclo(4.1.0)heptane-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
7,7-difluorobicyclo[4.1.0]heptane-2-carboxylic acid (CAS 2248316-21-2) is a chemical compound with the molecular formula C8H10F2O2 and a molecular weight of 176.16 g/mol. IUPAC name: 7,7-difluorobicyclo[4.1.0]heptane-2-carboxylic acid. InChIKey: BMGBIYJKZHLBHC-UHFFFAOYSA-N.
| Molecular formula | C8H10F2O2 |
|---|---|
| Molecular weight | 176.16 g/mol |
| IUPAC name | 7,7-difluorobicyclo[4.1.0]heptane-2-carboxylic acid |
| InChIKey | BMGBIYJKZHLBHC-UHFFFAOYSA-N |
| SMILES | C1CC(C2C(C1)C2(F)F)C(=O)O |
Computed by PubChem (NCBI)