CAS 1420-49-1 appears in our catalog under these names: Arimistane, >95% (HPLC), Androst–3,5–diene–7,17–dione, Androst-3,5-diene-7,17-dione, Arimistane, 99.90%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10g, 1g, 5g, 10mg, 5mg, 25g, 10 mg, 5 mg.
(8R,9S,10R,13S,14S)-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-7,17-dione (CAS 1420-49-1) is a chemical compound with the molecular formula C19H24O2 and a molecular weight of 284.4 g/mol. IUPAC name: (8R,9S,10R,13S,14S)-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-7,17-dione. InChIKey: VHDOTNMSJDQVEE-ZENYQMPMSA-N.
| Molecular formula | C19H24O2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (8R,9S,10R,13S,14S)-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-7,17-dione |
| InChIKey | VHDOTNMSJDQVEE-ZENYQMPMSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)C(=O)C=C4[C@@]3(CCC=C4)C |
Computed by PubChem (NCBI)