CAS 1421241-45-3 is the registry number for 7-Methyl-2-(4-methylphenyl)-5-nitro-1,3-benzoxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7-methyl-2-(4-methylphenyl)-5-nitro-1,3-benzoxazole (CAS 1421241-45-3) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 7-methyl-2-(4-methylphenyl)-5-nitro-1,3-benzoxazole. InChIKey: JGAVZDUXNZLBDX-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 7-methyl-2-(4-methylphenyl)-5-nitro-1,3-benzoxazole |
| InChIKey | JGAVZDUXNZLBDX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=C(O2)C(=CC(=C3)[N+](=O)[O-])C |
Computed by PubChem (NCBI)