CAS 1421602-03-0 appears in our catalog under these names: 2-(2,4-Difluorophenyl)piperidine hydrochloride, 98%, 2-(2,4-Difluorophenyl)piperidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(2,4-difluorophenyl)piperidine;hydrochloride (CAS 1421602-03-0) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: 2-(2,4-difluorophenyl)piperidine;hydrochloride. InChIKey: BCLOXKKMPTXDGT-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)piperidine;hydrochloride |
| InChIKey | BCLOXKKMPTXDGT-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=C(C=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)