CAS 1421604-95-6 is the registry number for 1-(1,3-Dioxaindan-5-yl)cyclopropan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(1,3-benzodioxol-5-yl)cyclopropan-1-amine;hydrochloride (CAS 1421604-95-6) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)cyclopropan-1-amine;hydrochloride. InChIKey: CXDLZZRWIVHMPD-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)cyclopropan-1-amine;hydrochloride |
| InChIKey | CXDLZZRWIVHMPD-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC3=C(C=C2)OCO3)N.Cl |
Computed by PubChem (NCBI)