CAS 1422344-03-3 appears in our catalog under these names: 2-(4-Chloro-phenyl)-cyclopropanecarbaldehyde, 95%, 2-(4-Chlorophenyl)cyclopropanecarbaldehyde 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
2-(4-chlorophenyl)cyclopropane-1-carbaldehyde (CAS 1422344-03-3) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 2-(4-chlorophenyl)cyclopropane-1-carbaldehyde. InChIKey: CVMYPHZJAWTPFF-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 2-(4-chlorophenyl)cyclopropane-1-carbaldehyde |
| InChIKey | CVMYPHZJAWTPFF-UHFFFAOYSA-N |
| SMILES | C1C(C1C2=CC=C(C=C2)Cl)C=O |
Computed by PubChem (NCBI)