CAS 1423-65-0 appears in our catalog under these names: Benzo[b]thiophene-6-carboxylic acid, methyl ester, 95%, Methyl benzo[b]thiophene-6-carboxylate 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 1-benzothiophene-6-carboxylate (CAS 1423-65-0) is a chemical compound with the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. IUPAC name: methyl 1-benzothiophene-6-carboxylate. InChIKey: LUAQLMFNQYOVPQ-UHFFFAOYSA-N.
| Molecular formula | C10H8O2S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | methyl 1-benzothiophene-6-carboxylate |
| InChIKey | LUAQLMFNQYOVPQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=CS2 |
Computed by PubChem (NCBI)