CAS 17375-82-5 appears in our catalog under these names: 2-Methyl-1-benzothiophene-3-carboxylic acid, 95%, 2-Methyl-1-benzothiophene-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 2,5g.
2-methyl-1-benzothiophene-3-carboxylic acid (CAS 17375-82-5) is a chemical compound with the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. IUPAC name: 2-methyl-1-benzothiophene-3-carboxylic acid. InChIKey: AFUYTLSLJWHYSV-UHFFFAOYSA-N.
| Molecular formula | C10H8O2S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 2-methyl-1-benzothiophene-3-carboxylic acid |
| InChIKey | AFUYTLSLJWHYSV-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2S1)C(=O)O |
Computed by PubChem (NCBI)