CAS 42435-82-5 is the registry number for 3-(Phenylthio)-2(5h)-furanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-phenylsulfanyl-2H-furan-5-one (CAS 42435-82-5) is a chemical compound with the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. IUPAC name: 4-phenylsulfanyl-2H-furan-5-one. InChIKey: NYSGNNULGPBKOK-UHFFFAOYSA-N.
| Molecular formula | C10H8O2S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 4-phenylsulfanyl-2H-furan-5-one |
| InChIKey | NYSGNNULGPBKOK-UHFFFAOYSA-N |
| SMILES | C1C=C(C(=O)O1)SC2=CC=CC=C2 |
Computed by PubChem (NCBI)