CAS 1505-62-0 appears in our catalog under these names: 5-Methyl-1-benzothiophene-2-carboxylic acid, 95%, 5-Methylbenzo(b)thiophene-2-carboxylic acid, 95+%, 5-Methylbenzo(b)thiophene-2-carboxylic acid, 5-Methylbenzo[b]thiophene-2-carboxylic acid 95+%, 5-Methylbenzo[b]thiophene-2-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg, 50mg, 500mg.
5-methyl-1-benzothiophene-2-carboxylic acid (CAS 1505-62-0) is a chemical compound with the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. IUPAC name: 5-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: OUFWTHMQVXSBCF-UHFFFAOYSA-N.
| Molecular formula | C10H8O2S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 5-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | OUFWTHMQVXSBCF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)