Products 1735-13-3
CAS 1735-13-3 appears in our catalog under these names: 4-Methylbenzo[b]thiophene-2-carboxylic acid, 95%, 4–Methylbenzo(b)thiophene–2–carboxylic acid, 4-Methylbenzo(b)thiophene-2-carboxylic acid, 4-Methylbenzo[b]thiophene-2-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 0,5g.
4-methyl-1-benzothiophene-2-carboxylic acid (CAS 1735-13-3) is a chemical compound with the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. IUPAC name: 4-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: OCANRQFAJMJHTR-UHFFFAOYSA-N.
| Molecular formula | C10H8O2S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 4-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | OCANRQFAJMJHTR-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(SC2=CC=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Methylbenzo[b]thiophene-2-carboxylic acid, 4-Methylbenzo(b)thiophene-2-carboxylic acid, 4-Methyl-1-benzothiophene-2-carboxylic acid, Benzo[b]thiophene-2-carboxylic acid, 4-methyl-, 4-Methylbenzothiophene-2-carboxylic Acid, 4-Methylbenzo[b]thiophene-2-carboxylicacid, 4-Methyl-1-benzothiophene-2-carboxylic acid #