CAS 3133-78-6 appears in our catalog under these names: 3–Methylbenzo(b)thiophene–2–carboxylic acid, 3-Methylbenzo[b]thiophene-2-carboxylic acid, 97% , 3-Methylbenzo(b)thiophene-2-carboxylic acid, 3-Methylbenzo[b]thiophene-2-carboxylic acid 98%, 3-Methylbenzo[b]thiophene-2-carboxylic acid, 97%, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 50g, 500g, 250mg, 100mg.
3-methyl-1-benzothiophene-2-carboxylic acid (CAS 3133-78-6) is a chemical compound with the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. IUPAC name: 3-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: YVKLUKXESFJRCE-UHFFFAOYSA-N.
| Molecular formula | C10H8O2S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 3-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | YVKLUKXESFJRCE-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=CC=CC=C12)C(=O)O |
Computed by PubChem (NCBI)