Products 1547060-42-3

CAS 1547060-42-3 is the registry number for 4-Methylbenzo[b]thiophene-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-methyl-1-benzothiophene-5-carboxylic acid (CAS 1547060-42-3) is a chemical compound with the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. IUPAC name: 4-methyl-1-benzothiophene-5-carboxylic acid. InChIKey: PTCDWRWOZOGXQT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8O2S
Molecular weight192.24 g/mol
IUPAC name4-methyl-1-benzothiophene-5-carboxylic acid
InChIKeyPTCDWRWOZOGXQT-UHFFFAOYSA-N
SMILESCC1=C(C=CC2=C1C=CS2)C(=O)O

Computed by PubChem (NCBI)