CAS 1423025-03-9 appears in our catalog under these names: Propan-2-yl 2-hydroxypyridine-4-carboxylate, 95%, Propan-2-yl 2-hydroxypyridine-4-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Propan-2-yl 2-oxo-1H-pyridine-4-carboxylate (CAS 1423025-03-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: propan-2-yl 2-oxo-1H-pyridine-4-carboxylate. InChIKey: ABUWUNCCHYQIFZ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | propan-2-yl 2-oxo-1H-pyridine-4-carboxylate |
| InChIKey | ABUWUNCCHYQIFZ-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC(=O)NC=C1 |
Computed by PubChem (NCBI)