CAS 1423027-85-3 appears in our catalog under these names: 2-Methyl-3-(pyridin-2-yl)benzoic acid, 2-Methyl-3-(pyridin-2-yl)benzoic acid, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2-methyl-3-pyridin-2-ylbenzoic acid (CAS 1423027-85-3) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 2-methyl-3-pyridin-2-ylbenzoic acid. InChIKey: JMXMNHHISPYCJY-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 2-methyl-3-pyridin-2-ylbenzoic acid |
| InChIKey | JMXMNHHISPYCJY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1C(=O)O)C2=CC=CC=N2 |
Computed by PubChem (NCBI)